C16H9N5 — CID 140949151
4,6,8,16,19-pentazapentacyclo[11.8.0.02,6.07,12.015,20]henicosa-1(21),2,4,7(12),8,10,13,15,17,19-decaene (PubChem CID 140949151) has the molecular formula C16H9N5 and a molecular weight of 271.28 g/mol. Its IUPAC name is 4,6,8,16,19-pentazapentacyclo[11.8.0.02,6.07,12.015,20]henicosa-1(21),2,4,7(12),8,10,13,15,17,19-decaene.
| Compound Name | 4,6,8,16,19-pentazapentacyclo[11.8.0.02,6.07,12.015,20]henicosa-1(21),2,4,7(12),8,10,13,15,17,19-decaene |
|---|---|
| PubChem CID | 140949151 |
| Molecular Formula | C16H9N5 |
| Molecular Weight | 271.28 g/mol |
| Exact Mass | 271.09 |
| IUPAC Name | 4,6,8,16,19-pentazapentacyclo[11.8.0.02,6.07,12.015,20]henicosa-1(21),2,4,7(12),8,10,13,15,17,19-decaene |
| SMILES | c1cnc2c(c1)c1cc3nccnc3cc1c1cncn12 |
| InChI | InChI=1S/C16H9N5/c1-2-10-11-6-13-14(19-5-4-18-13)7-12(11)15-8-17-9-21(15)16(10)20-3-1/h1-9H |
| InChIKey | FAYJHXIFFIABLQ-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 271.28 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|