C11H10N4 — CID 90955504
7,10-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene (PubChem CID 90955504) has the molecular formula C11H10N4 and a molecular weight of 198.23 g/mol. Its IUPAC name is 7,10-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene.
| Compound Name | 7,10-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene |
|---|---|
| PubChem CID | 90955504 |
| Molecular Formula | C11H10N4 |
| Molecular Weight | 198.23 g/mol |
| Exact Mass | 198.09 |
| IUPAC Name | 7,10-dimethyl-2,4,8,13-tetrazatricyclo[7.4.0.02,6]trideca-1(13),3,5,7,9,11-hexaene |
| SMILES | Cc1ccnc2c1nc(C)c1cncn12 |
| InChI | InChI=1S/C11H10N4/c1-7-3-4-13-11-10(7)14-8(2)9-5-12-6-15(9)11/h3-6H,1-2H3 |
| InChIKey | FVHKWWOVDCWXRM-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 43.08 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 198.23 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |