C12H7N5 — CID 140949970
2,5,9,11,17-pentazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7,9,11,14,16-octaene (PubChem CID 140949970) has the molecular formula C12H7N5 and a molecular weight of 221.22 g/mol. Its IUPAC name is 2,5,9,11,17-pentazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7,9,11,14,16-octaene.
| Compound Name | 2,5,9,11,17-pentazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7,9,11,14,16-octaene |
|---|---|
| PubChem CID | 140949970 |
| Molecular Formula | C12H7N5 |
| Molecular Weight | 221.22 g/mol |
| Exact Mass | 221.07 |
| IUPAC Name | 2,5,9,11,17-pentazatetracyclo[11.4.0.02,6.07,12]heptadeca-1(13),3,5,7,9,11,14,16-octaene |
| SMILES | c1cnc2c(c1)c1ncncc1c1nccn21 |
| InChI | InChI=1S/C12H7N5/c1-2-8-10-9(6-13-7-16-10)12-15-4-5-17(12)11(8)14-3-1/h1-7H |
| InChIKey | FHVPXWJBOXVYTD-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 55.97 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 221.22 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|