C39H20N4 — CID 140956089
22,23,24-triisocyano-16,18-diphenyl-19-azahexacyclo[12.11.0.02,7.08,13.015,19.020,25]pentacosa-1(14),2,4,6,8,10,12,15,17,20(25),21,23-dodecaene (PubChem CID 140956089) has the molecular formula C39H20N4 and a molecular weight of 544.62 g/mol. Its IUPAC name is 22,23,24-triisocyano-16,18-diphenyl-19-azahexacyclo[12.11.0.02,7.08,13.015,19.020,25]pentacosa-1(14),2,4,6,8,10,12,15,17,20(25),21,23-dodecaene.
| Compound Name | 22,23,24-triisocyano-16,18-diphenyl-19-azahexacyclo[12.11.0.02,7.08,13.015,19.020,25]pentacosa-1(14),2,4,6,8,10,12,15,17,20(25),21,23-dodecaene |
|---|---|
| PubChem CID | 140956089 |
| Molecular Formula | C39H20N4 |
| Molecular Weight | 544.62 g/mol |
| Exact Mass | 544.17 |
| IUPAC Name | 22,23,24-triisocyano-16,18-diphenyl-19-azahexacyclo[12.11.0.02,7.08,13.015,19.020,25]pentacosa-1(14),2,4,6,8,10,12,15,17,20(25),21,23-dodecaene |
| SMILES | [C-]#[N+]c1cc2c(c([N+]#[C-])c1[N+]#[C-])c1c3ccccc3c3ccccc3c1c1c(-c3ccccc3)cc(-c3ccccc3)n21 |
| InChI | InChI=1S/C39H20N4/c1-40-31-23-33-36(38(42-3)37(31)41-2)34-28-20-12-10-18-26(28)27-19-11-13-21-29(27)35(34)39-30(24-14-6-4-7-15-24)22-32(43(33)39)25-16-8-5-9-17-25/h4-23H |
| InChIKey | GSXLOOILCIGBDM-UHFFFAOYSA-N |
| XLogP | 11.54 |
| TPSA | 17.49 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 544.62 |
| LogP ≤ 5 | 11.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'Carbo_cation/anion', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'} |
|---|