C19H12N4O3S — CID 140960454
4-[4-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]phenoxy]benzonitrile (PubChem CID 140960454) has the molecular formula C19H12N4O3S and a molecular weight of 376.40 g/mol. Its IUPAC name is 4-[4-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]phenoxy]benzonitrile.
| Compound Name | 4-[4-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]phenoxy]benzonitrile |
|---|---|
| PubChem CID | 140960454 |
| Molecular Formula | C19H12N4O3S |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 4-[4-[1-(1,3-dioxo-1,2-thiazol-5-yl)pyrazol-4-yl]phenoxy]benzonitrile |
| SMILES | N#Cc1ccc(Oc2ccc(-c3cnn(C4=CC(=O)NS4=O)c3)cc2)cc1 |
| InChI | InChI=1S/C19H12N4O3S/c20-10-13-1-5-16(6-2-13)26-17-7-3-14(4-8-17)15-11-21-23(12-15)19-9-18(24)22-27(19)25/h1-9,11-12H,(H,22,24) |
| InChIKey | GQWFJFMUXREFGP-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 97.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |