C20H14N4O4S2 — CID 140960577
5-[4-[1-(benzenesulfonyl)indol-3-yl]pyrazol-1-yl]-1-oxo-1,2-thiazol-3-one (PubChem CID 140960577) has the molecular formula C20H14N4O4S2 and a molecular weight of 438.49 g/mol. Its IUPAC name is 5-[4-[1-(benzenesulfonyl)indol-3-yl]pyrazol-1-yl]-1-oxo-1,2-thiazol-3-one.
| Compound Name | 5-[4-[1-(benzenesulfonyl)indol-3-yl]pyrazol-1-yl]-1-oxo-1,2-thiazol-3-one |
|---|---|
| PubChem CID | 140960577 |
| Molecular Formula | C20H14N4O4S2 |
| Molecular Weight | 438.49 g/mol |
| Exact Mass | 438.05 |
| IUPAC Name | 5-[4-[1-(benzenesulfonyl)indol-3-yl]pyrazol-1-yl]-1-oxo-1,2-thiazol-3-one |
| SMILES | O=C1C=C(n2cc(-c3cn(S(=O)(=O)c4ccccc4)c4ccccc34)cn2)S(=O)N1 |
| InChI | InChI=1S/C20H14N4O4S2/c25-19-10-20(29(26)22-19)23-12-14(11-21-23)17-13-24(18-9-5-4-8-16(17)18)30(27,28)15-6-2-1-3-7-15/h1-13H,(H,22,25) |
| InChIKey | VFXSXSUEVHWPQD-UHFFFAOYSA-N |
| XLogP | 2.33 |
| TPSA | 103.06 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.49 |
| LogP ≤ 5 | 2.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |