C29H27N2O7S- — CID 140963407
3-[N-(3-carboxypropyl)-4-(3-diphenylazaniumylidene-2-oxido-4-oxocyclobuten-1-yl)anilino]propane-1-sulfonate (PubChem CID 140963407) has the molecular formula C29H27N2O7S- and a molecular weight of 547.61 g/mol. Its IUPAC name is 3-[N-(3-carboxypropyl)-4-(3-diphenylazaniumylidene-2-oxido-4-oxocyclobuten-1-yl)anilino]propane-1-sulfonate.
| Compound Name | 3-[N-(3-carboxypropyl)-4-(3-diphenylazaniumylidene-2-oxido-4-oxocyclobuten-1-yl)anilino]propane-1-sulfonate |
|---|---|
| PubChem CID | 140963407 |
| Molecular Formula | C29H27N2O7S- |
| Molecular Weight | 547.61 g/mol |
| Exact Mass | 547.15 |
| IUPAC Name | 3-[N-(3-carboxypropyl)-4-(3-diphenylazaniumylidene-2-oxido-4-oxocyclobuten-1-yl)anilino]propane-1-sulfonate |
| SMILES | O=C(O)CCCN(CCCS(=O)(=O)[O-])c1ccc(-c2c([O-])c(=[N+](c3ccccc3)c3ccccc3)c2=O)cc1 |
| InChI | InChI=1S/C29H28N2O7S/c32-25(33)13-7-18-30(19-8-20-39(36,37)38)22-16-14-21(15-17-22)26-28(34)27(29(26)35)31(23-9-3-1-4-10-23)24-11-5-2-6-12-24/h1-6,9-12,14-17H,7-8,13,18-20H2,(H2-,32,33,34,35,36,37,38)/p-1 |
| InChIKey | UKWRAORCBCLYPK-UHFFFAOYSA-M |
| XLogP | 2.71 |
| TPSA | 140.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 547.61 |
| LogP ≤ 5 | 2.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|