C29H30N2O7S — CID 140963370
4-[4-[2-hydroxy-4-oxo-3-(N-phenylanilino)cyclobuten-1-yl]-N-(3-sulfopropyl)anilino]butanoic acid (PubChem CID 140963370) has the molecular formula C29H30N2O7S and a molecular weight of 550.63 g/mol. Its IUPAC name is 4-[4-[2-hydroxy-4-oxo-3-(N-phenylanilino)cyclobuten-1-yl]-N-(3-sulfopropyl)anilino]butanoic acid.
| Compound Name | 4-[4-[2-hydroxy-4-oxo-3-(N-phenylanilino)cyclobuten-1-yl]-N-(3-sulfopropyl)anilino]butanoic acid |
|---|---|
| PubChem CID | 140963370 |
| Molecular Formula | C29H30N2O7S |
| Molecular Weight | 550.63 g/mol |
| Exact Mass | 550.18 |
| IUPAC Name | 4-[4-[2-hydroxy-4-oxo-3-(N-phenylanilino)cyclobuten-1-yl]-N-(3-sulfopropyl)anilino]butanoic acid |
| SMILES | O=C(O)CCCN(CCCS(=O)(=O)O)c1ccc(C2=C(O)C(N(c3ccccc3)c3ccccc3)C2=O)cc1 |
| InChI | InChI=1S/C29H30N2O7S/c32-25(33)13-7-18-30(19-8-20-39(36,37)38)22-16-14-21(15-17-22)26-28(34)27(29(26)35)31(23-9-3-1-4-10-23)24-11-5-2-6-12-24/h1-6,9-12,14-17,27,34H,7-8,13,18-20H2,(H,32,33)(H,36,37,38) |
| InChIKey | RBXMVPXFXKBEAB-UHFFFAOYSA-N |
| XLogP | 4.69 |
| TPSA | 135.45 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 550.63 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'anil_di_alk_B(251)', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|