C19H27N2+ — CID 140964687
5-cyclohexyl-1,4-dimethyl-3-(2-methylphenyl)-2-(trideuteriomethyl)imidazol-1-ium (PubChem CID 140964687) has the molecular formula C19H27N2+ and a molecular weight of 286.46 g/mol. Its IUPAC name is 5-cyclohexyl-1,4-dimethyl-3-(2-methylphenyl)-2-(trideuteriomethyl)imidazol-1-ium.
| Compound Name | 5-cyclohexyl-1,4-dimethyl-3-(2-methylphenyl)-2-(trideuteriomethyl)imidazol-1-ium |
|---|---|
| PubChem CID | 140964687 |
| Molecular Formula | C19H27N2+ |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.24 |
| IUPAC Name | 5-cyclohexyl-1,4-dimethyl-3-(2-methylphenyl)-2-(trideuteriomethyl)imidazol-1-ium |
| SMILES | [2H]C([2H])([2H])c1n(-c2ccccc2C)c(C)c(C2CCCCC2)[n+]1C |
| InChI | InChI=1S/C19H27N2/c1-14-10-8-9-13-18(14)21-15(2)19(20(4)16(21)3)17-11-6-5-7-12-17/h8-10,13,17H,5-7,11-12H2,1-4H3/q+1/i3D3 |
| InChIKey | UXNYHKHFJUNQPT-HPRDVNIFSA-N |
| XLogP | 4.27 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|