C23H27N2+ — CID 140964684
4-cyclopentyl-5-methyl-1-(2-methylphenyl)-3-phenyl-2-(trideuteriomethyl)imidazol-1-ium (PubChem CID 140964684) has the molecular formula C23H27N2+ and a molecular weight of 334.50 g/mol. Its IUPAC name is 4-cyclopentyl-5-methyl-1-(2-methylphenyl)-3-phenyl-2-(trideuteriomethyl)imidazol-1-ium.
| Compound Name | 4-cyclopentyl-5-methyl-1-(2-methylphenyl)-3-phenyl-2-(trideuteriomethyl)imidazol-1-ium |
|---|---|
| PubChem CID | 140964684 |
| Molecular Formula | C23H27N2+ |
| Molecular Weight | 334.50 g/mol |
| Exact Mass | 334.24 |
| IUPAC Name | 4-cyclopentyl-5-methyl-1-(2-methylphenyl)-3-phenyl-2-(trideuteriomethyl)imidazol-1-ium |
| SMILES | [2H]C([2H])([2H])c1n(-c2ccccc2)c(C2CCCC2)c(C)[n+]1-c1ccccc1C |
| InChI | InChI=1S/C23H27N2/c1-17-11-7-10-16-22(17)24-18(2)23(20-12-8-9-13-20)25(19(24)3)21-14-5-4-6-15-21/h4-7,10-11,14-16,20H,8-9,12-13H2,1-3H3/q+1/i3D3 |
| InChIKey | ABQYBFZYITUKOL-HPRDVNIFSA-N |
| XLogP | 5.34 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.50 |
| LogP ≤ 5 | 5.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|