C18H24NS+ — CID 140964528
2-cyclohexyl-4,5-dimethyl-3-(2-methylphenyl)-1,3-thiazol-3-ium (PubChem CID 140964528) has the molecular formula C18H24NS+ and a molecular weight of 286.46 g/mol. Its IUPAC name is 2-cyclohexyl-4,5-dimethyl-3-(2-methylphenyl)-1,3-thiazol-3-ium.
| Compound Name | 2-cyclohexyl-4,5-dimethyl-3-(2-methylphenyl)-1,3-thiazol-3-ium |
|---|---|
| PubChem CID | 140964528 |
| Molecular Formula | C18H24NS+ |
| Molecular Weight | 286.46 g/mol |
| Exact Mass | 286.16 |
| IUPAC Name | 2-cyclohexyl-4,5-dimethyl-3-(2-methylphenyl)-1,3-thiazol-3-ium |
| SMILES | Cc1ccccc1-[n+]1c(C2CCCCC2)sc(C)c1C |
| InChI | InChI=1S/C18H24NS/c1-13-9-7-8-12-17(13)19-14(2)15(3)20-18(19)16-10-5-4-6-11-16/h7-9,12,16H,4-6,10-11H2,1-3H3/q+1 |
| InChIKey | WXOVNIOZYQODMI-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 3.88 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 286.46 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|