C26H29N2+ — CID 140964761
3-cyclohexyl-7-deuterio-1-methyl-2-(2-methylphenyl)-7-phenylpyrrolo[1,2-c]imidazol-2-ium (PubChem CID 140964761) has the molecular formula C26H29N2+ and a molecular weight of 370.54 g/mol. Its IUPAC name is 3-cyclohexyl-7-deuterio-1-methyl-2-(2-methylphenyl)-7-phenylpyrrolo[1,2-c]imidazol-2-ium.
| Compound Name | 3-cyclohexyl-7-deuterio-1-methyl-2-(2-methylphenyl)-7-phenylpyrrolo[1,2-c]imidazol-2-ium |
|---|---|
| PubChem CID | 140964761 |
| Molecular Formula | C26H29N2+ |
| Molecular Weight | 370.54 g/mol |
| Exact Mass | 370.24 |
| IUPAC Name | 3-cyclohexyl-7-deuterio-1-methyl-2-(2-methylphenyl)-7-phenylpyrrolo[1,2-c]imidazol-2-ium |
| SMILES | [2H]C1(c2ccccc2)C=Cn2c1c(C)[n+](-c1ccccc1C)c2C1CCCCC1 |
| InChI | InChI=1S/C26H29N2/c1-19-11-9-10-16-24(19)28-20(2)25-23(21-12-5-3-6-13-21)17-18-27(25)26(28)22-14-7-4-8-15-22/h3,5-6,9-13,16-18,22-23H,4,7-8,14-15H2,1-2H3/q+1/i23D |
| InChIKey | IAOJOIUZCDTSPO-WBQFYUNPSA-N |
| XLogP | 6.05 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 370.54 |
| LogP ≤ 5 | 6.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|