C19H25N2+ — CID 159027179
3-tert-butyl-7-deuterio-1,7-dimethyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium (PubChem CID 159027179) has the molecular formula C19H25N2+ and a molecular weight of 282.43 g/mol. Its IUPAC name is 3-tert-butyl-7-deuterio-1,7-dimethyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium.
| Compound Name | 3-tert-butyl-7-deuterio-1,7-dimethyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium |
|---|---|
| PubChem CID | 159027179 |
| Molecular Formula | C19H25N2+ |
| Molecular Weight | 282.43 g/mol |
| Exact Mass | 282.21 |
| IUPAC Name | 3-tert-butyl-7-deuterio-1,7-dimethyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium |
| SMILES | [2H]C1(C)C=Cn2c1c(C)[n+](-c1ccccc1C)c2C(C)(C)C |
| InChI | InChI=1S/C19H25N2/c1-13-9-7-8-10-16(13)21-15(3)17-14(2)11-12-20(17)18(21)19(4,5)6/h7-12,14H,1-6H3/q+1/i14D |
| InChIKey | FPUSPCVQECMGDQ-FCFVPJCTSA-N |
| XLogP | 4.27 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.43 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|