C22H27N2+ — CID 140964863
2-tert-butyl-1,4-dimethyl-3-(2-methylphenyl)-5-phenylimidazol-1-ium (PubChem CID 140964863) has the molecular formula C22H27N2+ and a molecular weight of 319.47 g/mol. Its IUPAC name is 2-tert-butyl-1,4-dimethyl-3-(2-methylphenyl)-5-phenylimidazol-1-ium.
| Compound Name | 2-tert-butyl-1,4-dimethyl-3-(2-methylphenyl)-5-phenylimidazol-1-ium |
|---|---|
| PubChem CID | 140964863 |
| Molecular Formula | C22H27N2+ |
| Molecular Weight | 319.47 g/mol |
| Exact Mass | 319.22 |
| IUPAC Name | 2-tert-butyl-1,4-dimethyl-3-(2-methylphenyl)-5-phenylimidazol-1-ium |
| SMILES | Cc1ccccc1-n1c(C)c(-c2ccccc2)[n+](C)c1C(C)(C)C |
| InChI | InChI=1S/C22H27N2/c1-16-12-10-11-15-19(16)24-17(2)20(18-13-8-7-9-14-18)23(6)21(24)22(3,4)5/h7-15H,1-6H3/q+1 |
| InChIKey | UFKGZMNTDLUVKM-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.47 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|