C30H31N2+ — CID 140964877
3-tert-butyl-1-methyl-2-(2-methylphenyl)-5,5-diphenylpyrrolo[1,2-c]imidazol-4-ium (PubChem CID 140964877) has the molecular formula C30H31N2+ and a molecular weight of 419.59 g/mol. Its IUPAC name is 3-tert-butyl-1-methyl-2-(2-methylphenyl)-5,5-diphenylpyrrolo[1,2-c]imidazol-4-ium.
| Compound Name | 3-tert-butyl-1-methyl-2-(2-methylphenyl)-5,5-diphenylpyrrolo[1,2-c]imidazol-4-ium |
|---|---|
| PubChem CID | 140964877 |
| Molecular Formula | C30H31N2+ |
| Molecular Weight | 419.59 g/mol |
| Exact Mass | 419.25 |
| IUPAC Name | 3-tert-butyl-1-methyl-2-(2-methylphenyl)-5,5-diphenylpyrrolo[1,2-c]imidazol-4-ium |
| SMILES | Cc1ccccc1-n1c(C)c2[n+](c1C(C)(C)C)C(c1ccccc1)(c1ccccc1)C=C2 |
| InChI | InChI=1S/C30H31N2/c1-22-14-12-13-19-26(22)31-23(2)27-20-21-30(24-15-8-6-9-16-24,25-17-10-7-11-18-25)32(27)28(31)29(3,4)5/h6-21H,1-5H3/q+1 |
| InChIKey | WGUUWQRHCLAIJA-UHFFFAOYSA-N |
| XLogP | 6.50 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.59 |
| LogP ≤ 5 | 6.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|