C14H15N2O+ — CID 140964554
5,7-dimethyl-6-(2-methylphenyl)imidazo[5,1-b][1,3]oxazol-4-ium (PubChem CID 140964554) has the molecular formula C14H15N2O+ and a molecular weight of 227.29 g/mol. Its IUPAC name is 5,7-dimethyl-6-(2-methylphenyl)imidazo[5,1-b][1,3]oxazol-4-ium.
| Compound Name | 5,7-dimethyl-6-(2-methylphenyl)imidazo[5,1-b][1,3]oxazol-4-ium |
|---|---|
| PubChem CID | 140964554 |
| Molecular Formula | C14H15N2O+ |
| Molecular Weight | 227.29 g/mol |
| Exact Mass | 227.12 |
| IUPAC Name | 5,7-dimethyl-6-(2-methylphenyl)imidazo[5,1-b][1,3]oxazol-4-ium |
| SMILES | Cc1ccccc1-n1c(C)c2occ[n+]2c1C |
| InChI | InChI=1S/C14H15N2O/c1-10-6-4-5-7-13(10)16-11(2)14-15(12(16)3)8-9-17-14/h4-9H,1-3H3/q+1 |
| InChIKey | WBTNOUSYZQKNSH-UHFFFAOYSA-N |
| XLogP | 2.73 |
| TPSA | 22.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 227.29 |
| LogP ≤ 5 | 2.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|