C31H27N2+ — CID 140964909
3-methyl-2-(2-methylphenyl)-4,4-diphenyl-1-(trideuteriomethyl)imidazo[1,5-a]indol-9-ium (PubChem CID 140964909) has the molecular formula C31H27N2+ and a molecular weight of 430.59 g/mol. Its IUPAC name is 3-methyl-2-(2-methylphenyl)-4,4-diphenyl-1-(trideuteriomethyl)imidazo[1,5-a]indol-9-ium.
| Compound Name | 3-methyl-2-(2-methylphenyl)-4,4-diphenyl-1-(trideuteriomethyl)imidazo[1,5-a]indol-9-ium |
|---|---|
| PubChem CID | 140964909 |
| Molecular Formula | C31H27N2+ |
| Molecular Weight | 430.59 g/mol |
| Exact Mass | 430.24 |
| IUPAC Name | 3-methyl-2-(2-methylphenyl)-4,4-diphenyl-1-(trideuteriomethyl)imidazo[1,5-a]indol-9-ium |
| SMILES | [2H]C([2H])([2H])c1n(-c2ccccc2C)c(C)c2[n+]1-c1ccccc1C2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C31H27N2/c1-22-14-10-12-20-28(22)32-23(2)30-31(25-15-6-4-7-16-25,26-17-8-5-9-18-26)27-19-11-13-21-29(27)33(30)24(32)3/h4-21H,1-3H3/q+1/i3D3 |
| InChIKey | HCZIFTYJZQIZON-HPRDVNIFSA-N |
| XLogP | 6.38 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.59 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|