C26H31N2+ — CID 140964900
4-cyclohexyl-1,3,4-trimethyl-2-(2-methylphenyl)imidazo[1,5-a]indol-9-ium (PubChem CID 140964900) has the molecular formula C26H31N2+ and a molecular weight of 371.55 g/mol. Its IUPAC name is 4-cyclohexyl-1,3,4-trimethyl-2-(2-methylphenyl)imidazo[1,5-a]indol-9-ium.
| Compound Name | 4-cyclohexyl-1,3,4-trimethyl-2-(2-methylphenyl)imidazo[1,5-a]indol-9-ium |
|---|---|
| PubChem CID | 140964900 |
| Molecular Formula | C26H31N2+ |
| Molecular Weight | 371.55 g/mol |
| Exact Mass | 371.25 |
| IUPAC Name | 4-cyclohexyl-1,3,4-trimethyl-2-(2-methylphenyl)imidazo[1,5-a]indol-9-ium |
| SMILES | Cc1ccccc1-n1c(C)c2[n+](c1C)-c1ccccc1C2(C)C1CCCCC1 |
| InChI | InChI=1S/C26H31N2/c1-18-12-8-10-16-23(18)27-19(2)25-26(4,21-13-6-5-7-14-21)22-15-9-11-17-24(22)28(25)20(27)3/h8-12,15-17,21H,5-7,13-14H2,1-4H3/q+1 |
| InChIKey | WYPOOOAZUYWIRZ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 371.55 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|