C27H37N2+ — CID 140964973
5,5-dicyclohexyl-1,3-dimethyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-4-ium (PubChem CID 140964973) has the molecular formula C27H37N2+ and a molecular weight of 389.61 g/mol. Its IUPAC name is 5,5-dicyclohexyl-1,3-dimethyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-4-ium.
| Compound Name | 5,5-dicyclohexyl-1,3-dimethyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-4-ium |
|---|---|
| PubChem CID | 140964973 |
| Molecular Formula | C27H37N2+ |
| Molecular Weight | 389.61 g/mol |
| Exact Mass | 389.30 |
| IUPAC Name | 5,5-dicyclohexyl-1,3-dimethyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-4-ium |
| SMILES | Cc1ccccc1-n1c(C)c2[n+](c1C)C(C1CCCCC1)(C1CCCCC1)C=C2 |
| InChI | InChI=1S/C27H37N2/c1-20-12-10-11-17-25(20)28-21(2)26-18-19-27(29(26)22(28)3,23-13-6-4-7-14-23)24-15-8-5-9-16-24/h10-12,17-19,23-24H,4-9,13-16H2,1-3H3/q+1 |
| InChIKey | LCMUWADQECBQLW-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.61 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|