C32H33N2+ — CID 140964451
5-cyclohexyl-1-methyl-2-(2-methylphenyl)-3,5-diphenylpyrrolo[1,2-c]imidazol-4-ium (PubChem CID 140964451) has the molecular formula C32H33N2+ and a molecular weight of 445.63 g/mol. Its IUPAC name is 5-cyclohexyl-1-methyl-2-(2-methylphenyl)-3,5-diphenylpyrrolo[1,2-c]imidazol-4-ium.
| Compound Name | 5-cyclohexyl-1-methyl-2-(2-methylphenyl)-3,5-diphenylpyrrolo[1,2-c]imidazol-4-ium |
|---|---|
| PubChem CID | 140964451 |
| Molecular Formula | C32H33N2+ |
| Molecular Weight | 445.63 g/mol |
| Exact Mass | 445.26 |
| IUPAC Name | 5-cyclohexyl-1-methyl-2-(2-methylphenyl)-3,5-diphenylpyrrolo[1,2-c]imidazol-4-ium |
| SMILES | Cc1ccccc1-n1c(C)c2[n+](c1-c1ccccc1)C(c1ccccc1)(C1CCCCC1)C=C2 |
| InChI | InChI=1S/C32H33N2/c1-24-14-12-13-21-29(24)33-25(2)30-22-23-32(27-17-8-4-9-18-27,28-19-10-5-11-20-28)34(30)31(33)26-15-6-3-7-16-26/h3-4,6-9,12-18,21-23,28H,5,10-11,19-20H2,1-2H3/q+1 |
| InChIKey | UOQFPLMXAQCDKC-UHFFFAOYSA-N |
| XLogP | 7.40 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 445.63 |
| LogP ≤ 5 | 7.40 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|