C31H35N2+ — CID 140965151
1-cyclohexyl-2-(2,6-dimethylphenyl)-4-methyl-3-(2-methylphenyl)-5-phenylimidazol-1-ium (PubChem CID 140965151) has the molecular formula C31H35N2+ and a molecular weight of 435.64 g/mol. Its IUPAC name is 1-cyclohexyl-2-(2,6-dimethylphenyl)-4-methyl-3-(2-methylphenyl)-5-phenylimidazol-1-ium.
| Compound Name | 1-cyclohexyl-2-(2,6-dimethylphenyl)-4-methyl-3-(2-methylphenyl)-5-phenylimidazol-1-ium |
|---|---|
| PubChem CID | 140965151 |
| Molecular Formula | C31H35N2+ |
| Molecular Weight | 435.64 g/mol |
| Exact Mass | 435.28 |
| IUPAC Name | 1-cyclohexyl-2-(2,6-dimethylphenyl)-4-methyl-3-(2-methylphenyl)-5-phenylimidazol-1-ium |
| SMILES | Cc1ccccc1-n1c(C)c(-c2ccccc2)[n+](C2CCCCC2)c1-c1c(C)cccc1C |
| InChI | InChI=1S/C31H35N2/c1-22-14-11-12-21-28(22)32-25(4)30(26-17-7-5-8-18-26)33(27-19-9-6-10-20-27)31(32)29-23(2)15-13-16-24(29)3/h5,7-8,11-18,21,27H,6,9-10,19-20H2,1-4H3/q+1 |
| InChIKey | GZIMPWSUIZEINF-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.64 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|