C34H31N2+ — CID 140965056
3-(2,6-dimethylphenyl)-1-methyl-2-(2-methylphenyl)-7,7-diphenylpyrrolo[1,2-c]imidazol-4-ium (PubChem CID 140965056) has the molecular formula C34H31N2+ and a molecular weight of 467.64 g/mol. Its IUPAC name is 3-(2,6-dimethylphenyl)-1-methyl-2-(2-methylphenyl)-7,7-diphenylpyrrolo[1,2-c]imidazol-4-ium.
| Compound Name | 3-(2,6-dimethylphenyl)-1-methyl-2-(2-methylphenyl)-7,7-diphenylpyrrolo[1,2-c]imidazol-4-ium |
|---|---|
| PubChem CID | 140965056 |
| Molecular Formula | C34H31N2+ |
| Molecular Weight | 467.64 g/mol |
| Exact Mass | 467.25 |
| IUPAC Name | 3-(2,6-dimethylphenyl)-1-methyl-2-(2-methylphenyl)-7,7-diphenylpyrrolo[1,2-c]imidazol-4-ium |
| SMILES | Cc1ccccc1-n1c(C)c2[n+](c1-c1c(C)cccc1C)C=CC2(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C34H31N2/c1-24-14-11-12-21-30(24)36-27(4)32-34(28-17-7-5-8-18-28,29-19-9-6-10-20-29)22-23-35(32)33(36)31-25(2)15-13-16-26(31)3/h5-23H,1-4H3/q+1 |
| InChIKey | YVLYHYWUALKTAY-UHFFFAOYSA-N |
| XLogP | 7.48 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 467.64 |
| LogP ≤ 5 | 7.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|