C31H33N2+ — CID 140964758
5-cyclopentyl-5-deuterio-3-(2,6-dimethylphenyl)-1-methyl-2-(2-methylphenyl)imidazo[5,1-a]isoindol-4-ium (PubChem CID 140964758) has the molecular formula C31H33N2+ and a molecular weight of 434.63 g/mol. Its IUPAC name is 5-cyclopentyl-5-deuterio-3-(2,6-dimethylphenyl)-1-methyl-2-(2-methylphenyl)imidazo[5,1-a]isoindol-4-ium.
| Compound Name | 5-cyclopentyl-5-deuterio-3-(2,6-dimethylphenyl)-1-methyl-2-(2-methylphenyl)imidazo[5,1-a]isoindol-4-ium |
|---|---|
| PubChem CID | 140964758 |
| Molecular Formula | C31H33N2+ |
| Molecular Weight | 434.63 g/mol |
| Exact Mass | 434.27 |
| IUPAC Name | 5-cyclopentyl-5-deuterio-3-(2,6-dimethylphenyl)-1-methyl-2-(2-methylphenyl)imidazo[5,1-a]isoindol-4-ium |
| SMILES | [2H]C1(C2CCCC2)c2ccccc2-c2c(C)n(-c3ccccc3C)c(-c3c(C)cccc3C)[n+]21 |
| InChI | InChI=1S/C31H33N2/c1-20-12-5-10-19-27(20)32-23(4)29-25-17-8-9-18-26(25)30(24-15-6-7-16-24)33(29)31(32)28-21(2)13-11-14-22(28)3/h5,8-14,17-19,24,30H,6-7,15-16H2,1-4H3/q+1/i30D |
| InChIKey | CGYJCWOIXAMARH-OBXIQSIWSA-N |
| XLogP | 7.43 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 434.63 |
| LogP ≤ 5 | 7.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|