C21H32N2 — CID 162706297
(4S)-1,5-dicyclopentyl-2-deuterio-4-methyl-3-(2-methylphenyl)imidazolidine (PubChem CID 162706297) has the molecular formula C21H32N2 and a molecular weight of 313.51 g/mol. Its IUPAC name is (4S)-1,5-dicyclopentyl-2-deuterio-4-methyl-3-(2-methylphenyl)imidazolidine.
| Compound Name | (4S)-1,5-dicyclopentyl-2-deuterio-4-methyl-3-(2-methylphenyl)imidazolidine |
|---|---|
| PubChem CID | 162706297 |
| Molecular Formula | C21H32N2 |
| Molecular Weight | 313.51 g/mol |
| Exact Mass | 313.26 |
| IUPAC Name | (4S)-1,5-dicyclopentyl-2-deuterio-4-methyl-3-(2-methylphenyl)imidazolidine |
| SMILES | [2H]C1N(C2CCCC2)C(C2CCCC2)[C@H](C)N1c1ccccc1C |
| InChI | InChI=1S/C21H32N2/c1-16-9-3-8-14-20(16)22-15-23(19-12-6-7-13-19)21(17(22)2)18-10-4-5-11-18/h3,8-9,14,17-19,21H,4-7,10-13,15H2,1-2H3/t17-,21?/m0/s1/i15D/t15?,17-,21? |
| InChIKey | HQVONZDEZXZRGO-MWAQUOBISA-N |
| XLogP | 4.96 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 313.51 |
| LogP ≤ 5 | 4.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |