C23H30N2 — CID 162706315
(4S)-5-cyclohexyl-1-deuterio-4-methyl-3-(2-methylphenyl)-2-phenylimidazolidine (PubChem CID 162706315) has the molecular formula C23H30N2 and a molecular weight of 335.51 g/mol. Its IUPAC name is (4S)-5-cyclohexyl-1-deuterio-4-methyl-3-(2-methylphenyl)-2-phenylimidazolidine.
| Compound Name | (4S)-5-cyclohexyl-1-deuterio-4-methyl-3-(2-methylphenyl)-2-phenylimidazolidine |
|---|---|
| PubChem CID | 162706315 |
| Molecular Formula | C23H30N2 |
| Molecular Weight | 335.51 g/mol |
| Exact Mass | 335.25 |
| IUPAC Name | (4S)-5-cyclohexyl-1-deuterio-4-methyl-3-(2-methylphenyl)-2-phenylimidazolidine |
| SMILES | [2H]N1C(C2CCCCC2)[C@H](C)N(c2ccccc2C)C1c1ccccc1 |
| InChI | InChI=1S/C23H30N2/c1-17-11-9-10-16-21(17)25-18(2)22(19-12-5-3-6-13-19)24-23(25)20-14-7-4-8-15-20/h4,7-11,14-16,18-19,22-24H,3,5-6,12-13H2,1-2H3/t18-,22?,23?/m0/s1/i/hD |
| InChIKey | AHZYMDXIAUDANK-FTGLAVGISA-N |
| XLogP | 5.44 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.51 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |