C25H30N2 — CID 162706596
(1S)-5-cyclopentyl-5-deuterio-1-methyl-2-(2-methylphenyl)-3-phenyl-3,7a-dihydro-1H-pyrrolo[1,2-c]imidazole (PubChem CID 162706596) has the molecular formula C25H30N2 and a molecular weight of 359.54 g/mol. Its IUPAC name is (1S)-5-cyclopentyl-5-deuterio-1-methyl-2-(2-methylphenyl)-3-phenyl-3,7a-dihydro-1H-pyrrolo[1,2-c]imidazole.
| Compound Name | (1S)-5-cyclopentyl-5-deuterio-1-methyl-2-(2-methylphenyl)-3-phenyl-3,7a-dihydro-1H-pyrrolo[1,2-c]imidazole |
|---|---|
| PubChem CID | 162706596 |
| Molecular Formula | C25H30N2 |
| Molecular Weight | 359.54 g/mol |
| Exact Mass | 359.25 |
| IUPAC Name | (1S)-5-cyclopentyl-5-deuterio-1-methyl-2-(2-methylphenyl)-3-phenyl-3,7a-dihydro-1H-pyrrolo[1,2-c]imidazole |
| SMILES | [2H]C1(C2CCCC2)C=CC2[C@H](C)N(c3ccccc3C)C(c3ccccc3)N21 |
| InChI | InChI=1S/C25H30N2/c1-18-10-6-9-15-22(18)26-19(2)23-16-17-24(20-11-7-8-12-20)27(23)25(26)21-13-4-3-5-14-21/h3-6,9-10,13-17,19-20,23-25H,7-8,11-12H2,1-2H3/t19-,23?,24?,25?/m0/s1/i24D |
| InChIKey | MXTDYBFVSXCQCE-QGHMFACISA-N |
| XLogP | 5.70 |
| TPSA | 6.48 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 359.54 |
| LogP ≤ 5 | 5.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|