C32H39N2+ — CID 140964867
7,7-dicyclopentyl-3-(2,6-dimethylphenyl)-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-4-ium (PubChem CID 140964867) has the molecular formula C32H39N2+ and a molecular weight of 451.68 g/mol. Its IUPAC name is 7,7-dicyclopentyl-3-(2,6-dimethylphenyl)-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-4-ium.
| Compound Name | 7,7-dicyclopentyl-3-(2,6-dimethylphenyl)-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-4-ium |
|---|---|
| PubChem CID | 140964867 |
| Molecular Formula | C32H39N2+ |
| Molecular Weight | 451.68 g/mol |
| Exact Mass | 451.31 |
| IUPAC Name | 7,7-dicyclopentyl-3-(2,6-dimethylphenyl)-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-4-ium |
| SMILES | Cc1ccccc1-n1c(C)c2[n+](c1-c1c(C)cccc1C)C=CC2(C1CCCC1)C1CCCC1 |
| InChI | InChI=1S/C32H39N2/c1-22-12-5-10-19-28(22)34-25(4)30-32(26-15-6-7-16-26,27-17-8-9-18-27)20-21-33(30)31(34)29-23(2)13-11-14-24(29)3/h5,10-14,19-21,26-27H,6-9,15-18H2,1-4H3/q+1 |
| InChIKey | JVJCFVLVQIHRCZ-UHFFFAOYSA-N |
| XLogP | 7.77 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.68 |
| LogP ≤ 5 | 7.77 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|