C14H13N2OS+ — CID 177128965
4-methyl-3-(2-methylphenyl)-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-thione (PubChem CID 177128965) has the molecular formula C14H13N2OS+ and a molecular weight of 257.34 g/mol. Its IUPAC name is 4-methyl-3-(2-methylphenyl)-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-thione.
| Compound Name | 4-methyl-3-(2-methylphenyl)-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-thione |
|---|---|
| PubChem CID | 177128965 |
| Molecular Formula | C14H13N2OS+ |
| Molecular Weight | 257.34 g/mol |
| Exact Mass | 257.07 |
| IUPAC Name | 4-methyl-3-(2-methylphenyl)-[1,3]oxazolo[4,5-b]pyridin-4-ium-2-thione |
| SMILES | Cc1ccccc1-n1c(=S)oc2ccc[n+](C)c21 |
| InChI | InChI=1S/C14H13N2OS/c1-10-6-3-4-7-11(10)16-13-12(17-14(16)18)8-5-9-15(13)2/h3-9H,1-2H3/q+1 |
| InChIKey | XDUIVJXYCHVAEV-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 21.95 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 257.34 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|