C21H23N2O+ — CID 140964990
1-tert-butyl-3-methyl-2-(2-methylphenyl)imidazo[5,1-b][1,3]benzoxazol-9-ium (PubChem CID 140964990) has the molecular formula C21H23N2O+ and a molecular weight of 319.43 g/mol. Its IUPAC name is 1-tert-butyl-3-methyl-2-(2-methylphenyl)imidazo[5,1-b][1,3]benzoxazol-9-ium.
| Compound Name | 1-tert-butyl-3-methyl-2-(2-methylphenyl)imidazo[5,1-b][1,3]benzoxazol-9-ium |
|---|---|
| PubChem CID | 140964990 |
| Molecular Formula | C21H23N2O+ |
| Molecular Weight | 319.43 g/mol |
| Exact Mass | 319.18 |
| IUPAC Name | 1-tert-butyl-3-methyl-2-(2-methylphenyl)imidazo[5,1-b][1,3]benzoxazol-9-ium |
| SMILES | Cc1ccccc1-n1c(C)c2oc3ccccc3[n+]2c1C(C)(C)C |
| InChI | InChI=1S/C21H23N2O/c1-14-10-6-7-11-16(14)22-15(2)19-23(20(22)21(3,4)5)17-12-8-9-13-18(17)24-19/h6-13H,1-5H3/q+1 |
| InChIKey | QOTCGIKNFBCUFH-UHFFFAOYSA-N |
| XLogP | 4.88 |
| TPSA | 22.17 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.43 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|