C12H12N3OS+ — CID 177128856
4-methyl-3-(3-methyl-1H-imidazol-3-ium-2-yl)-1,3-benzoxazole-2-thione (PubChem CID 177128856) has the molecular formula C12H12N3OS+ and a molecular weight of 246.31 g/mol. Its IUPAC name is 4-methyl-3-(3-methyl-1H-imidazol-3-ium-2-yl)-1,3-benzoxazole-2-thione.
| Compound Name | 4-methyl-3-(3-methyl-1H-imidazol-3-ium-2-yl)-1,3-benzoxazole-2-thione |
|---|---|
| PubChem CID | 177128856 |
| Molecular Formula | C12H12N3OS+ |
| Molecular Weight | 246.31 g/mol |
| Exact Mass | 246.07 |
| IUPAC Name | 4-methyl-3-(3-methyl-1H-imidazol-3-ium-2-yl)-1,3-benzoxazole-2-thione |
| SMILES | Cc1cccc2oc(=S)n(-c3[nH]cc[n+]3C)c12 |
| InChI | InChI=1S/C12H11N3OS/c1-8-4-3-5-9-10(8)15(12(17)16-9)11-13-6-7-14(11)2/h3-7H,1-2H3/p+1 |
| InChIKey | ATWINLKKUQLRMA-UHFFFAOYSA-O |
| XLogP | 2.41 |
| TPSA | 37.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.31 |
| LogP ≤ 5 | 2.41 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|