C17H17N2+ — CID 171436488
1-methyl-9-(2-methylphenyl)pyrido[2,3-b]azepin-1-ium (PubChem CID 171436488) has the molecular formula C17H17N2+ and a molecular weight of 249.34 g/mol. Its IUPAC name is 1-methyl-9-(2-methylphenyl)pyrido[2,3-b]azepin-1-ium.
| Compound Name | 1-methyl-9-(2-methylphenyl)pyrido[2,3-b]azepin-1-ium |
|---|---|
| PubChem CID | 171436488 |
| Molecular Formula | C17H17N2+ |
| Molecular Weight | 249.34 g/mol |
| Exact Mass | 249.14 |
| IUPAC Name | 1-methyl-9-(2-methylphenyl)pyrido[2,3-b]azepin-1-ium |
| SMILES | Cc1ccccc1N1C=CC=Cc2ccc[n+](C)c21 |
| InChI | InChI=1S/C17H17N2/c1-14-8-3-4-11-16(14)19-13-6-5-9-15-10-7-12-18(2)17(15)19/h3-13H,1-2H3/q+1 |
| InChIKey | SRIRWZRSQYVJSO-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 7.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.34 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|