C16H18N3+ — CID 171436430
9-methyl-1-(2-methylphenyl)-2,3-dihydropyrido[2,3-d][1,3]diazepin-9-ium (PubChem CID 171436430) has the molecular formula C16H18N3+ and a molecular weight of 252.34 g/mol. Its IUPAC name is 9-methyl-1-(2-methylphenyl)-2,3-dihydropyrido[2,3-d][1,3]diazepin-9-ium.
| Compound Name | 9-methyl-1-(2-methylphenyl)-2,3-dihydropyrido[2,3-d][1,3]diazepin-9-ium |
|---|---|
| PubChem CID | 171436430 |
| Molecular Formula | C16H18N3+ |
| Molecular Weight | 252.34 g/mol |
| Exact Mass | 252.15 |
| IUPAC Name | 9-methyl-1-(2-methylphenyl)-2,3-dihydropyrido[2,3-d][1,3]diazepin-9-ium |
| SMILES | Cc1ccccc1N1CNC=Cc2ccc[n+](C)c21 |
| InChI | InChI=1S/C16H18N3/c1-13-6-3-4-8-15(13)19-12-17-10-9-14-7-5-11-18(2)16(14)19/h3-11,17H,12H2,1-2H3/q+1 |
| InChIKey | CMKFPUMXRIMNAF-UHFFFAOYSA-N |
| XLogP | 2.49 |
| TPSA | 19.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 252.34 |
| LogP ≤ 5 | 2.49 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|