C14H16BIN3+ — CID 174066846
2-iodo-1,4-dimethyl-3-(2-methylphenyl)-[1,3,2]diazaborolo[4,5-b]pyridin-4-ium (PubChem CID 174066846) has the molecular formula C14H16BIN3+ and a molecular weight of 364.02 g/mol. Its IUPAC name is 2-iodo-1,4-dimethyl-3-(2-methylphenyl)-[1,3,2]diazaborolo[4,5-b]pyridin-4-ium.
| Compound Name | 2-iodo-1,4-dimethyl-3-(2-methylphenyl)-[1,3,2]diazaborolo[4,5-b]pyridin-4-ium |
|---|---|
| PubChem CID | 174066846 |
| Molecular Formula | C14H16BIN3+ |
| Molecular Weight | 364.02 g/mol |
| Exact Mass | 364.05 |
| IUPAC Name | 2-iodo-1,4-dimethyl-3-(2-methylphenyl)-[1,3,2]diazaborolo[4,5-b]pyridin-4-ium |
| SMILES | Cc1ccccc1N1B(I)N(C)c2ccc[n+](C)c21 |
| InChI | InChI=1S/C14H16BIN3/c1-11-7-4-5-8-12(11)19-14-13(18(3)15(19)16)9-6-10-17(14)2/h4-10H,1-3H3/q+1 |
| InChIKey | LIRQUIHLXDTNQI-UHFFFAOYSA-N |
| XLogP | 2.83 |
| TPSA | 10.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.02 |
| LogP ≤ 5 | 2.83 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|