C24H29N2+ — CID 140964856
4-cyclohexyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazol-1-ium (PubChem CID 140964856) has the molecular formula C24H29N2+ and a molecular weight of 345.51 g/mol. Its IUPAC name is 4-cyclohexyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazol-1-ium.
| Compound Name | 4-cyclohexyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazol-1-ium |
|---|---|
| PubChem CID | 140964856 |
| Molecular Formula | C24H29N2+ |
| Molecular Weight | 345.51 g/mol |
| Exact Mass | 345.23 |
| IUPAC Name | 4-cyclohexyl-2,5-dimethyl-1-(2-methylphenyl)-3-phenylimidazol-1-ium |
| SMILES | Cc1ccccc1-[n+]1c(C)c(C2CCCCC2)n(-c2ccccc2)c1C |
| InChI | InChI=1S/C24H29N2/c1-18-12-10-11-17-23(18)25-19(2)24(21-13-6-4-7-14-21)26(20(25)3)22-15-8-5-9-16-22/h5,8-12,15-17,21H,4,6-7,13-14H2,1-3H3/q+1 |
| InChIKey | XQZFOPLCZLSKCH-UHFFFAOYSA-N |
| XLogP | 5.73 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.51 |
| LogP ≤ 5 | 5.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|