C23H33N2+ — CID 140964981
2,5-dicyclohexyl-1-deuterio-4-methyl-3-(2-methylphenyl)imidazol-3-ium (PubChem CID 140964981) has the molecular formula C23H33N2+ and a molecular weight of 338.54 g/mol. Its IUPAC name is 2,5-dicyclohexyl-1-deuterio-4-methyl-3-(2-methylphenyl)imidazol-3-ium.
| Compound Name | 2,5-dicyclohexyl-1-deuterio-4-methyl-3-(2-methylphenyl)imidazol-3-ium |
|---|---|
| PubChem CID | 140964981 |
| Molecular Formula | C23H33N2+ |
| Molecular Weight | 338.54 g/mol |
| Exact Mass | 338.27 |
| IUPAC Name | 2,5-dicyclohexyl-1-deuterio-4-methyl-3-(2-methylphenyl)imidazol-3-ium |
| SMILES | [2H]n1c(C2CCCCC2)c(C)[n+](-c2ccccc2C)c1C1CCCCC1 |
| InChI | InChI=1S/C23H32N2/c1-17-11-9-10-16-21(17)25-18(2)22(19-12-5-3-6-13-19)24-23(25)20-14-7-4-8-15-20/h9-11,16,19-20H,3-8,12-15H2,1-2H3/p+1/i/hD |
| InChIKey | VXEIQQDVFDULBQ-DYCDLGHISA-O |
| XLogP | 6.00 |
| TPSA | 19.67 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.54 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|