About 5,5-dicyclohexyl-3-deuterio-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium
5,5-dicyclohexyl-3-deuterio-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium (PubChem CID 140964526) has the molecular formula C26H35N2+
and a molecular weight of 376.59 g/mol. Its IUPAC name is 5,5-dicyclohexyl-3-deuterio-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium.
Molecular Properties
| Compound Name | 5,5-dicyclohexyl-3-deuterio-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium |
| PubChem CID | 140964526 |
| Molecular Formula | C26H35N2+ |
| Molecular Weight | 376.59 g/mol |
| Exact Mass | 376.29 |
| IUPAC Name | 5,5-dicyclohexyl-3-deuterio-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium |
| SMILES | [2H]c1n2c(c(C)[n+]1-c1ccccc1C)C=CC2(C1CCCCC1)C1CCCCC1 |
| InChI | InChI=1S/C26H35N2/c1-20-11-9-10-16-24(20)27-19-28-25(21(27)2)17-18-26(28,22-12-5-3-6-13-22)23-14-7-4-8-15-23/h9-11,16-19,22-23H,3-8,12-15H2,1-2H3/q+1/i19D |
| InChIKey | IUJZBFKZJHFHNX-YUIGOLOMSA-N |
| XLogP | 6.26 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 376.59 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|
Analyze 5,5-dicyclohexyl-3-deuterio-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5,5-dicyclohexyl-3-deuterio-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium?
The IUPAC name of 5,5-dicyclohexyl-3-deuterio-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium (CID 140964526) is 5,5-dicyclohexyl-3-deuterio-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium.
What is the SMILES notation for 5,5-dicyclohexyl-3-deuterio-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium?
The canonical SMILES for 5,5-dicyclohexyl-3-deuterio-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium is [2H]c1n2c(c(C)[n+]1-c1ccccc1C)C=CC2(C1CCCCC1)C1CCCCC1.
What is the InChIKey of 5,5-dicyclohexyl-3-deuterio-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium?
The InChIKey is IUJZBFKZJHFHNX-YUIGOLOMSA-N. The full InChI is InChI=1S/C26H35N2/c1-20-11-9-10-16-24(20)27-19-28-25(21(27)2)17-18-26(28,22-12-5-3-6-13-22)23-14-7-4-8-15-23/h9-11,16-19,22-23H,3-8,12-15H2,1-2H3/q+1/i19D.
What are the key properties of 5,5-dicyclohexyl-3-deuterio-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium?
5,5-dicyclohexyl-3-deuterio-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium has a molecular weight of 376.59 g/mol, XLogP of 6.26, 3 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 5,5-dicyclohexyl-3-deuterio-1-methyl-2-(2-methylphenyl)pyrrolo[1,2-c]imidazol-2-ium is sourced from PubChem (CID 140964526), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).