C30H31N2+ — CID 140965039
4-cyclohexyl-1-deuterio-3-methyl-2-(2-methylphenyl)-4-phenylimidazo[1,5-a]indol-2-ium (PubChem CID 140965039) has the molecular formula C30H31N2+ and a molecular weight of 420.60 g/mol. Its IUPAC name is 4-cyclohexyl-1-deuterio-3-methyl-2-(2-methylphenyl)-4-phenylimidazo[1,5-a]indol-2-ium.
| Compound Name | 4-cyclohexyl-1-deuterio-3-methyl-2-(2-methylphenyl)-4-phenylimidazo[1,5-a]indol-2-ium |
|---|---|
| PubChem CID | 140965039 |
| Molecular Formula | C30H31N2+ |
| Molecular Weight | 420.60 g/mol |
| Exact Mass | 420.25 |
| IUPAC Name | 4-cyclohexyl-1-deuterio-3-methyl-2-(2-methylphenyl)-4-phenylimidazo[1,5-a]indol-2-ium |
| SMILES | [2H]c1n2c(c(C)[n+]1-c1ccccc1C)C(c1ccccc1)(C1CCCCC1)c1ccccc1-2 |
| InChI | InChI=1S/C30H31N2/c1-22-13-9-11-19-27(22)31-21-32-28-20-12-10-18-26(28)30(29(32)23(31)2,24-14-5-3-6-15-24)25-16-7-4-8-17-25/h3,5-6,9-15,18-21,25H,4,7-8,16-17H2,1-2H3/q+1/i21D |
| InChIKey | OAFMIWBTBQNSCF-KRLANHAZSA-N |
| XLogP | 6.60 |
| TPSA | 8.81 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.60 |
| LogP ≤ 5 | 6.60 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|