C25H28N5O+ — CID 140965514
1-methyl-2-[1-[[4-(1-methylpyrrolidin-3-yl)phenyl]methyl]indol-5-yl]pyrazol-1-ium-4-carboxamide (PubChem CID 140965514) has the molecular formula C25H28N5O+ and a molecular weight of 414.53 g/mol. Its IUPAC name is 1-methyl-2-[1-[[4-(1-methylpyrrolidin-3-yl)phenyl]methyl]indol-5-yl]pyrazol-1-ium-4-carboxamide.
| Compound Name | 1-methyl-2-[1-[[4-(1-methylpyrrolidin-3-yl)phenyl]methyl]indol-5-yl]pyrazol-1-ium-4-carboxamide |
|---|---|
| PubChem CID | 140965514 |
| Molecular Formula | C25H28N5O+ |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.23 |
| IUPAC Name | 1-methyl-2-[1-[[4-(1-methylpyrrolidin-3-yl)phenyl]methyl]indol-5-yl]pyrazol-1-ium-4-carboxamide |
| SMILES | CN1CCC(c2ccc(Cn3ccc4cc(-n5cc(C(N)=O)c[n+]5C)ccc43)cc2)C1 |
| InChI | InChI=1S/C25H27N5O/c1-27-11-9-21(15-27)19-5-3-18(4-6-19)14-29-12-10-20-13-23(7-8-24(20)29)30-17-22(25(26)31)16-28(30)2/h3-8,10,12-13,16-17,21H,9,11,14-15H2,1-2H3,(H-,26,31)/p+1 |
| InChIKey | HOCHFSSEFBIJMO-UHFFFAOYSA-O |
| XLogP | 2.82 |
| TPSA | 60.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|