C16H11N7OS — CID 140968854
5-[4-(1H-pyrazol-5-yl)-2-(1H-pyrrol-2-yl)-5-thiophen-2-ylfuran-3-yl]-2H-tetrazole (PubChem CID 140968854) has the molecular formula C16H11N7OS and a molecular weight of 349.38 g/mol. Its IUPAC name is 5-[4-(1H-pyrazol-5-yl)-2-(1H-pyrrol-2-yl)-5-thiophen-2-ylfuran-3-yl]-2H-tetrazole.
| Compound Name | 5-[4-(1H-pyrazol-5-yl)-2-(1H-pyrrol-2-yl)-5-thiophen-2-ylfuran-3-yl]-2H-tetrazole |
|---|---|
| PubChem CID | 140968854 |
| Molecular Formula | C16H11N7OS |
| Molecular Weight | 349.38 g/mol |
| Exact Mass | 349.07 |
| IUPAC Name | 5-[4-(1H-pyrazol-5-yl)-2-(1H-pyrrol-2-yl)-5-thiophen-2-ylfuran-3-yl]-2H-tetrazole |
| SMILES | c1c[nH]c(-c2oc(-c3cccs3)c(-c3ccn[nH]3)c2-c2nn[nH]n2)c1 |
| InChI | InChI=1S/C16H11N7OS/c1-3-10(17-6-1)14-13(16-20-22-23-21-16)12(9-5-7-18-19-9)15(24-14)11-4-2-8-25-11/h1-8,17H,(H,18,19)(H,20,21,22,23) |
| InChIKey | SJVLEZVNTJVINB-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 112.07 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 349.38 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |