C10H10ClFN2O — CID 140970268
3-chloro-1-(6-fluoro-2,3-dihydro-1H-benzimidazol-5-yl)propan-1-one (PubChem CID 140970268) has the molecular formula C10H10ClFN2O and a molecular weight of 228.65 g/mol. Its IUPAC name is 3-chloro-1-(6-fluoro-2,3-dihydro-1H-benzimidazol-5-yl)propan-1-one.
| Compound Name | 3-chloro-1-(6-fluoro-2,3-dihydro-1H-benzimidazol-5-yl)propan-1-one |
|---|---|
| PubChem CID | 140970268 |
| Molecular Formula | C10H10ClFN2O |
| Molecular Weight | 228.65 g/mol |
| Exact Mass | 228.05 |
| IUPAC Name | 3-chloro-1-(6-fluoro-2,3-dihydro-1H-benzimidazol-5-yl)propan-1-one |
| SMILES | O=C(CCCl)c1cc2c(cc1F)NCN2 |
| InChI | InChI=1S/C10H10ClFN2O/c11-2-1-10(15)6-3-8-9(4-7(6)12)14-5-13-8/h3-4,13-14H,1-2,5H2 |
| InChIKey | JDZPYMILAHHZSY-UHFFFAOYSA-N |
| XLogP | 2.43 |
| TPSA | 41.13 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.65 |
| LogP ≤ 5 | 2.43 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|