C30H52O4Si — CID 140971564
methyl 2-[(3S,8R,9S,10S,13S,14S)-10-methyl-3-tri(propan-2-yl)silylperoxy-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-13-yl]acetate (PubChem CID 140971564) has the molecular formula C30H52O4Si and a molecular weight of 504.83 g/mol. Its IUPAC name is methyl 2-[(3S,8R,9S,10S,13S,14S)-10-methyl-3-tri(propan-2-yl)silylperoxy-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-13-yl]acetate.
| Compound Name | methyl 2-[(3S,8R,9S,10S,13S,14S)-10-methyl-3-tri(propan-2-yl)silylperoxy-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-13-yl]acetate |
|---|---|
| PubChem CID | 140971564 |
| Molecular Formula | C30H52O4Si |
| Molecular Weight | 504.83 g/mol |
| Exact Mass | 504.36 |
| IUPAC Name | methyl 2-[(3S,8R,9S,10S,13S,14S)-10-methyl-3-tri(propan-2-yl)silylperoxy-2,3,4,5,6,7,8,9,11,12,14,15-dodecahydro-1H-cyclopenta[a]phenanthren-13-yl]acetate |
| SMILES | COC(=O)C[C@@]12C=CC[C@H]1[C@@H]1CCC3C[C@@H](OO[Si](C(C)C)(C(C)C)C(C)C)CC[C@]3(C)[C@H]1CC2 |
| InChI | InChI=1S/C30H52O4Si/c1-20(2)35(21(3)4,22(5)6)34-33-24-13-16-29(7)23(18-24)11-12-25-26(29)14-17-30(19-28(31)32-8)15-9-10-27(25)30/h9,15,20-27H,10-14,16-19H2,1-8H3/t23?,24-,25+,26-,27-,29-,30-/m0/s1 |
| InChIKey | QUMUDOUCIAGACR-SUHKCPDXSA-N |
| XLogP | 8.23 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.83 |
| LogP ≤ 5 | 8.23 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'peroxide', 'substructure': 'N/A'} |
|---|