C39H56O3Si — CID 70825099
methyl 3-[(3R,10S,13R)-3-[tert-butyl(diphenyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoate (PubChem CID 70825099) has the molecular formula C39H56O3Si and a molecular weight of 600.96 g/mol. Its IUPAC name is methyl 3-[(3R,10S,13R)-3-[tert-butyl(diphenyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoate.
| Compound Name | methyl 3-[(3R,10S,13R)-3-[tert-butyl(diphenyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoate |
|---|---|
| PubChem CID | 70825099 |
| Molecular Formula | C39H56O3Si |
| Molecular Weight | 600.96 g/mol |
| Exact Mass | 600.40 |
| IUPAC Name | methyl 3-[(3R,10S,13R)-3-[tert-butyl(diphenyl)silyl]oxy-10,13-dimethyl-2,3,4,5,6,7,8,9,11,12,14,15,16,17-tetradecahydro-1H-cyclopenta[a]phenanthren-17-yl]propanoate |
| SMILES | COC(=O)CCC1CCC2C3CCC4C[C@H](O[Si](c5ccccc5)(c5ccccc5)C(C)(C)C)CC[C@]4(C)C3CC[C@]12C |
| InChI | InChI=1S/C39H56O3Si/c1-37(2,3)43(31-13-9-7-10-14-31,32-15-11-8-12-16-32)42-30-23-25-39(5)29(27-30)17-20-33-34-21-18-28(19-22-36(40)41-6)38(34,4)26-24-35(33)39/h7-16,28-30,33-35H,17-27H2,1-6H3/t28?,29?,30-,33?,34?,35?,38-,39+/m1/s1 |
| InChIKey | PETMMVQZWOTVGT-ZBTLXTMXSA-N |
| XLogP | 8.54 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.96 |
| LogP ≤ 5 | 8.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|