C13H17Cl2NO2S — CID 140978552
1-(3,4-dichlorophenyl)-3-(2-methylsulfonylethyl)pyrrolidine (PubChem CID 140978552) has the molecular formula C13H17Cl2NO2S and a molecular weight of 322.26 g/mol. Its IUPAC name is 1-(3,4-dichlorophenyl)-3-(2-methylsulfonylethyl)pyrrolidine.
| Compound Name | 1-(3,4-dichlorophenyl)-3-(2-methylsulfonylethyl)pyrrolidine |
|---|---|
| PubChem CID | 140978552 |
| Molecular Formula | C13H17Cl2NO2S |
| Molecular Weight | 322.26 g/mol |
| Exact Mass | 321.04 |
| IUPAC Name | 1-(3,4-dichlorophenyl)-3-(2-methylsulfonylethyl)pyrrolidine |
| SMILES | CS(=O)(=O)CCC1CCN(c2ccc(Cl)c(Cl)c2)C1 |
| InChI | InChI=1S/C13H17Cl2NO2S/c1-19(17,18)7-5-10-4-6-16(9-10)11-2-3-12(14)13(15)8-11/h2-3,8,10H,4-7,9H2,1H3 |
| InChIKey | OPMQJWJHBYGGLX-UHFFFAOYSA-N |
| XLogP | 3.25 |
| TPSA | 37.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 322.26 |
| LogP ≤ 5 | 3.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |