C21H14F2NO2+ — CID 140979144
2,3-difluoro-10-methyl-1-phenylacridin-10-ium-9-carboxylic acid (PubChem CID 140979144) has the molecular formula C21H14F2NO2+ and a molecular weight of 350.34 g/mol. Its IUPAC name is 2,3-difluoro-10-methyl-1-phenylacridin-10-ium-9-carboxylic acid.
| Compound Name | 2,3-difluoro-10-methyl-1-phenylacridin-10-ium-9-carboxylic acid |
|---|---|
| PubChem CID | 140979144 |
| Molecular Formula | C21H14F2NO2+ |
| Molecular Weight | 350.34 g/mol |
| Exact Mass | 350.10 |
| IUPAC Name | 2,3-difluoro-10-methyl-1-phenylacridin-10-ium-9-carboxylic acid |
| SMILES | C[n+]1c2ccccc2c(C(=O)O)c2c(-c3ccccc3)c(F)c(F)cc21 |
| InChI | InChI=1S/C21H13F2NO2/c1-24-15-10-6-5-9-13(15)18(21(25)26)19-16(24)11-14(22)20(23)17(19)12-7-3-2-4-8-12/h2-11H,1H3/p+1 |
| InChIKey | MNUOKZIVVDAMQG-UHFFFAOYSA-O |
| XLogP | 4.46 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.34 |
| LogP ≤ 5 | 4.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|