C25H21BrNO2+ — CID 154095058
3-(4-bromo-2,6-dimethylphenyl)-1-methyl-2-phenylquinolin-1-ium-4-carboxylic acid (PubChem CID 154095058) has the molecular formula C25H21BrNO2+ and a molecular weight of 447.35 g/mol. Its IUPAC name is 3-(4-bromo-2,6-dimethylphenyl)-1-methyl-2-phenylquinolin-1-ium-4-carboxylic acid.
| Compound Name | 3-(4-bromo-2,6-dimethylphenyl)-1-methyl-2-phenylquinolin-1-ium-4-carboxylic acid |
|---|---|
| PubChem CID | 154095058 |
| Molecular Formula | C25H21BrNO2+ |
| Molecular Weight | 447.35 g/mol |
| Exact Mass | 446.08 |
| IUPAC Name | 3-(4-bromo-2,6-dimethylphenyl)-1-methyl-2-phenylquinolin-1-ium-4-carboxylic acid |
| SMILES | Cc1cc(Br)cc(C)c1-c1c(C(=O)O)c2ccccc2[n+](C)c1-c1ccccc1 |
| InChI | InChI=1S/C25H20BrNO2/c1-15-13-18(26)14-16(2)21(15)23-22(25(28)29)19-11-7-8-12-20(19)27(3)24(23)17-9-5-4-6-10-17/h4-14H,1-3H3/p+1 |
| InChIKey | UIDQXTVUONPKQH-UHFFFAOYSA-O |
| XLogP | 6.08 |
| TPSA | 41.18 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.35 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|