C26H23N2O2+ — CID 54514808
1-[4-(2-cyanoethyl)-2,6-dimethylphenyl]-10-methylacridin-10-ium-9-carboxylic acid (PubChem CID 54514808) has the molecular formula C26H23N2O2+ and a molecular weight of 395.48 g/mol. Its IUPAC name is 1-[4-(2-cyanoethyl)-2,6-dimethylphenyl]-10-methylacridin-10-ium-9-carboxylic acid.
| Compound Name | 1-[4-(2-cyanoethyl)-2,6-dimethylphenyl]-10-methylacridin-10-ium-9-carboxylic acid |
|---|---|
| PubChem CID | 54514808 |
| Molecular Formula | C26H23N2O2+ |
| Molecular Weight | 395.48 g/mol |
| Exact Mass | 395.18 |
| IUPAC Name | 1-[4-(2-cyanoethyl)-2,6-dimethylphenyl]-10-methylacridin-10-ium-9-carboxylic acid |
| SMILES | Cc1cc(CCC#N)cc(C)c1-c1cccc2c1c(C(=O)O)c1ccccc1[n+]2C |
| InChI | InChI=1S/C26H22N2O2/c1-16-14-18(8-7-13-27)15-17(2)23(16)20-10-6-12-22-24(20)25(26(29)30)19-9-4-5-11-21(19)28(22)3/h4-6,9-12,14-15H,7-8H2,1-3H3/p+1 |
| InChIKey | YLRDMCMIUBQMPO-UHFFFAOYSA-O |
| XLogP | 5.26 |
| TPSA | 64.97 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 395.48 |
| LogP ≤ 5 | 5.26 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'het_pyridiniums_A(39)', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_2', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'} |
|---|