benzo[k]fluoranthene-7,12-dicarboxylic acid

C22H12O4 — CID 170873622

IUPACbenzo[k]fluoranthene-7,12-dicarboxylic acid
SMILESO=C(O)c1c2c(c(C(=O)O)c3ccccc13)-c1cccc3cccc-2c13
InChIInChI=1S/C22H12O4/c23-21(24)19-12-7-1-2-8-13(12)20(22(25)26)18-15-10-4-6-11-5-3-9-14(16(11)15)17(18)19/h1-10H,(H,23,24)(H,25,26)
InChIKeyWPNQEOUTAQERSS-UHFFFAOYSA-N
MW340.33 g/mol
LogP5.04
Rot. Bonds2

About benzo[k]fluoranthene-7,12-dicarboxylic acid

benzo[k]fluoranthene-7,12-dicarboxylic acid (PubChem CID 170873622) has the molecular formula C22H12O4 and a molecular weight of 340.33 g/mol. Its IUPAC name is benzo[k]fluoranthene-7,12-dicarboxylic acid.

Molecular Properties

Compound Namebenzo[k]fluoranthene-7,12-dicarboxylic acid
PubChem CID170873622
Molecular FormulaC22H12O4
Molecular Weight340.33 g/mol
Exact Mass340.07
IUPAC Namebenzo[k]fluoranthene-7,12-dicarboxylic acid
SMILESO=C(O)c1c2c(c(C(=O)O)c3ccccc13)-c1cccc3cccc-2c13
InChIInChI=1S/C22H12O4/c23-21(24)19-12-7-1-2-8-13(12)20(22(25)26)18-15-10-4-6-11-5-3-9-14(16(11)15)17(18)19/h1-10H,(H,23,24)(H,25,26)
InChIKeyWPNQEOUTAQERSS-UHFFFAOYSA-N
XLogP5.04
TPSA74.60 Ų
H-Bond Donors2
H-Bond Acceptors2
Rotatable Bonds2
Heavy Atoms26
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500340.33
LogP ≤ 55.04
H-Bond Donors ≤ 52
H-Bond Acceptors ≤ 102

Analyze benzo[k]fluoranthene-7,12-dicarboxylic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of benzo[k]fluoranthene-7,12-dicarboxylic acid?
The IUPAC name of benzo[k]fluoranthene-7,12-dicarboxylic acid (CID 170873622) is benzo[k]fluoranthene-7,12-dicarboxylic acid.
What is the SMILES notation for benzo[k]fluoranthene-7,12-dicarboxylic acid?
The canonical SMILES for benzo[k]fluoranthene-7,12-dicarboxylic acid is O=C(O)c1c2c(c(C(=O)O)c3ccccc13)-c1cccc3cccc-2c13.
What is the InChIKey of benzo[k]fluoranthene-7,12-dicarboxylic acid?
The InChIKey is WPNQEOUTAQERSS-UHFFFAOYSA-N. The full InChI is InChI=1S/C22H12O4/c23-21(24)19-12-7-1-2-8-13(12)20(22(25)26)18-15-10-4-6-11-5-3-9-14(16(11)15)17(18)19/h1-10H,(H,23,24)(H,25,26).
What are the key properties of benzo[k]fluoranthene-7,12-dicarboxylic acid?
benzo[k]fluoranthene-7,12-dicarboxylic acid has a molecular weight of 340.33 g/mol, XLogP of 5.04, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for benzo[k]fluoranthene-7,12-dicarboxylic acid is sourced from PubChem (CID 170873622), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).