C22H12O4 — CID 170873622
benzo[k]fluoranthene-7,12-dicarboxylic acid (PubChem CID 170873622) has the molecular formula C22H12O4 and a molecular weight of 340.33 g/mol. Its IUPAC name is benzo[k]fluoranthene-7,12-dicarboxylic acid.
| Compound Name | benzo[k]fluoranthene-7,12-dicarboxylic acid |
|---|---|
| PubChem CID | 170873622 |
| Molecular Formula | C22H12O4 |
| Molecular Weight | 340.33 g/mol |
| Exact Mass | 340.07 |
| IUPAC Name | benzo[k]fluoranthene-7,12-dicarboxylic acid |
| SMILES | O=C(O)c1c2c(c(C(=O)O)c3ccccc13)-c1cccc3cccc-2c13 |
| InChI | InChI=1S/C22H12O4/c23-21(24)19-12-7-1-2-8-13(12)20(22(25)26)18-15-10-4-6-11-5-3-9-14(16(11)15)17(18)19/h1-10H,(H,23,24)(H,25,26) |
| InChIKey | WPNQEOUTAQERSS-UHFFFAOYSA-N |
| XLogP | 5.04 |
| TPSA | 74.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.33 |
| LogP ≤ 5 | 5.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |