C13H13Cl3O2 — CID 14098166
6,7-dichloro-2-(3-chloropropyl)-5-methoxy-2,3-dihydroinden-1-one (PubChem CID 14098166) has the molecular formula C13H13Cl3O2 and a molecular weight of 307.60 g/mol. Its IUPAC name is 6,7-dichloro-2-(3-chloropropyl)-5-methoxy-2,3-dihydroinden-1-one.
| Compound Name | 6,7-dichloro-2-(3-chloropropyl)-5-methoxy-2,3-dihydroinden-1-one |
|---|---|
| PubChem CID | 14098166 |
| Molecular Formula | C13H13Cl3O2 |
| Molecular Weight | 307.60 g/mol |
| Exact Mass | 306.00 |
| IUPAC Name | 6,7-dichloro-2-(3-chloropropyl)-5-methoxy-2,3-dihydroinden-1-one |
| SMILES | COc1cc2c(c(Cl)c1Cl)C(=O)C(CCCCl)C2 |
| InChI | InChI=1S/C13H13Cl3O2/c1-18-9-6-8-5-7(3-2-4-14)13(17)10(8)12(16)11(9)15/h6-7H,2-5H2,1H3 |
| InChIKey | QBHIUAJKUGQWFJ-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.60 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|