C16H16Cl2O4 — CID 54410330
ethyl 2-[(6,7-dichloro-1-oxo-2-prop-2-enyl-2,3-dihydroinden-5-yl)oxy]acetate (PubChem CID 54410330) has the molecular formula C16H16Cl2O4 and a molecular weight of 343.21 g/mol. Its IUPAC name is ethyl 2-[(6,7-dichloro-1-oxo-2-prop-2-enyl-2,3-dihydroinden-5-yl)oxy]acetate.
| Compound Name | ethyl 2-[(6,7-dichloro-1-oxo-2-prop-2-enyl-2,3-dihydroinden-5-yl)oxy]acetate |
|---|---|
| PubChem CID | 54410330 |
| Molecular Formula | C16H16Cl2O4 |
| Molecular Weight | 343.21 g/mol |
| Exact Mass | 342.04 |
| IUPAC Name | ethyl 2-[(6,7-dichloro-1-oxo-2-prop-2-enyl-2,3-dihydroinden-5-yl)oxy]acetate |
| SMILES | C=CCC1Cc2cc(OCC(=O)OCC)c(Cl)c(Cl)c2C1=O |
| InChI | InChI=1S/C16H16Cl2O4/c1-3-5-9-6-10-7-11(22-8-12(19)21-4-2)14(17)15(18)13(10)16(9)20/h3,7,9H,1,4-6,8H2,2H3 |
| InChIKey | VTQYNRYHGFNCDU-UHFFFAOYSA-N |
| XLogP | 3.87 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.21 |
| LogP ≤ 5 | 3.87 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|