C13H13F3N4O2S — CID 140981818
2-amino-N-[2-(methylamino)-6-(trifluoromethyl)-4-pyridinyl]benzenesulfonamide (PubChem CID 140981818) has the molecular formula C13H13F3N4O2S and a molecular weight of 346.33 g/mol. Its IUPAC name is 2-amino-N-[2-(methylamino)-6-(trifluoromethyl)-4-pyridinyl]benzenesulfonamide.
| Compound Name | 2-amino-N-[2-(methylamino)-6-(trifluoromethyl)-4-pyridinyl]benzenesulfonamide |
|---|---|
| PubChem CID | 140981818 |
| Molecular Formula | C13H13F3N4O2S |
| Molecular Weight | 346.33 g/mol |
| Exact Mass | 346.07 |
| IUPAC Name | 2-amino-N-[2-(methylamino)-6-(trifluoromethyl)-4-pyridinyl]benzenesulfonamide |
| SMILES | CNc1cc(NS(=O)(=O)c2ccccc2N)cc(C(F)(F)F)n1 |
| InChI | InChI=1S/C13H13F3N4O2S/c1-18-12-7-8(6-11(19-12)13(14,15)16)20-23(21,22)10-5-3-2-4-9(10)17/h2-7H,17H2,1H3,(H2,18,19,20) |
| InChIKey | BHTDCPVQEUCWSW-UHFFFAOYSA-N |
| XLogP | 2.53 |
| TPSA | 97.11 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.33 |
| LogP ≤ 5 | 2.53 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|